C33H34Cl2FN3O3 — CID 25024624
ethyl (2S,3S)-3-[[1-(2,4-dichlorophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 25024624) has the molecular formula C33H34Cl2FN3O3 and a molecular weight of 610.56 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[1-(2,4-dichlorophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[1-(2,4-dichlorophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 25024624 |
| Molecular Formula | C33H34Cl2FN3O3 |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | ethyl (2S,3S)-3-[[1-(2,4-dichlorophenyl)-8-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carbonyl]amino]-4-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2C=CC(C)(C2)[C@H]1NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c2c1CCCCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C33H34Cl2FN3O3/c1-3-42-32(41)27-21-13-14-33(2,18-21)30(27)37-31(40)28-24-10-5-4-8-20(15-19-7-6-9-23(36)16-19)29(24)39(38-28)26-12-11-22(34)17-25(26)35/h6-7,9,11-14,16-17,20-21,27,30H,3-5,8,10,15,18H2,1-2H3,(H,37,40)/t20?,21?,27-,30-,33?/m0/s1 |
| InChIKey | GMBOKPSGNQOWKU-NJWYQKDOSA-N |
| XLogP | 7.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|