C31H36FN3O2 — CID 58882503
(8R)-1-cyclohexyl-8-[(3-fluorophenyl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide (PubChem CID 58882503) has the molecular formula C31H36FN3O2 and a molecular weight of 501.65 g/mol. Its IUPAC name is (8R)-1-cyclohexyl-8-[(3-fluorophenyl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | (8R)-1-cyclohexyl-8-[(3-fluorophenyl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 58882503 |
| Molecular Formula | C31H36FN3O2 |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | (8R)-1-cyclohexyl-8-[(3-fluorophenyl)methyl]-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1c2ccccc2C[C@@H]1O)c1nn(C2CCCCC2)c2c1CCCC[C@@H]2Cc1cccc(F)c1 |
| InChI | InChI=1S/C31H36FN3O2/c32-23-12-8-9-20(18-23)17-22-11-5-7-16-26-29(34-35(30(22)26)24-13-2-1-3-14-24)31(37)33-28-25-15-6-4-10-21(25)19-27(28)36/h4,6,8-10,12,15,18,22,24,27-28,36H,1-3,5,7,11,13-14,16-17,19H2,(H,33,37)/t22-,27+,28-/m1/s1 |
| InChIKey | YFAUASOABRGDBH-KKVCJECGSA-N |
| XLogP | 5.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |