C23H19F2N3O2 — CID 123882049
(2S,4S)-9-(2,4-difluorophenyl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 123882049) has the molecular formula C23H19F2N3O2 and a molecular weight of 407.42 g/mol. Its IUPAC name is (2S,4S)-9-(2,4-difluorophenyl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2S,4S)-9-(2,4-difluorophenyl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 123882049 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2S,4S)-9-(2,4-difluorophenyl)-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)c1nn(-c2ccc(F)cc2F)c2c1C[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C23H19F2N3O2/c24-13-5-6-18(17(25)10-13)28-22-15-7-12(15)8-16(22)21(27-28)23(30)26-20-14-4-2-1-3-11(14)9-19(20)29/h1-6,10,12,15,19-20,29H,7-9H2,(H,26,30)/t12-,15-,19+,20-/m0/s1 |
| InChIKey | QIXDBAIBKNHZCU-XUQGBBHRSA-N |
| XLogP | 3.20 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |