C21H24F2N4O — CID 123294108
(2S,4S)-9-(2,4-difluorophenyl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 123294108) has the molecular formula C21H24F2N4O and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S,4S)-9-(2,4-difluorophenyl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2S,4S)-9-(2,4-difluorophenyl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 123294108 |
| Molecular Formula | C21H24F2N4O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (2S,4S)-9-(2,4-difluorophenyl)-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)c1nn(-c2ccc(F)cc2F)c2c1C[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C21H24F2N4O/c1-2-26-7-3-4-14(26)11-24-21(28)19-16-9-12-8-15(12)20(16)27(25-19)18-6-5-13(22)10-17(18)23/h5-6,10,12,14-15H,2-4,7-9,11H2,1H3,(H,24,28)/t12-,14+,15-/m0/s1 |
| InChIKey | BBAGUCMTGPTFQO-CFVMTHIKSA-N |
| XLogP | 3.02 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |