C22H26F2N4O3 — CID 123684385
(2R,4R)-9-(2,4-difluorophenyl)-N-[1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 123684385) has the molecular formula C22H26F2N4O3 and a molecular weight of 432.47 g/mol. Its IUPAC name is (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 123684385 |
| Molecular Formula | C22H26F2N4O3 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (2R,4R)-9-(2,4-difluorophenyl)-N-[1-(2-hydroxyethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(-c2ccc(F)cc2F)c2c1C[C@H]1C[C@@H]21)C(=O)NCCO |
| InChI | InChI=1S/C22H26F2N4O3/c1-22(2,3)19(21(31)25-6-7-29)26-20(30)17-14-9-11-8-13(11)18(14)28(27-17)16-5-4-12(23)10-15(16)24/h4-5,10-11,13,19,29H,6-9H2,1-3H3,(H,25,31)(H,26,30)/t11-,13-,19?/m1/s1 |
| InChIKey | FQMIJFGEYVUTEW-XKPULOPMSA-N |
| XLogP | 2.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |