C33H40FN3O2 — CID 145479696
(8R)-1-cyclohexyl-8-[2-(4-fluorophenyl)ethyl]-N-[[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide (PubChem CID 145479696) has the molecular formula C33H40FN3O2 and a molecular weight of 529.70 g/mol. Its IUPAC name is (8R)-1-cyclohexyl-8-[2-(4-fluorophenyl)ethyl]-N-[[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | (8R)-1-cyclohexyl-8-[2-(4-fluorophenyl)ethyl]-N-[[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 145479696 |
| Molecular Formula | C33H40FN3O2 |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | (8R)-1-cyclohexyl-8-[2-(4-fluorophenyl)ethyl]-N-[[(1S,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(NC[C@@H]1c2ccccc2C[C@@H]1O)c1nn(C2CCCCC2)c2c1CCCC[C@@H]2CCc1ccc(F)cc1 |
| InChI | InChI=1S/C33H40FN3O2/c34-25-18-15-22(16-19-25)14-17-23-8-4-7-13-28-31(36-37(32(23)28)26-10-2-1-3-11-26)33(39)35-21-29-27-12-6-5-9-24(27)20-30(29)38/h5-6,9,12,15-16,18-19,23,26,29-30,38H,1-4,7-8,10-11,13-14,17,20-21H2,(H,35,39)/t23-,29-,30+/m1/s1 |
| InChIKey | UVTVDIHCHBVCLA-NWSMARCJSA-N |
| XLogP | 6.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |