C32H38FN3O — CID 59836330
1-(4-fluorophenyl)-7-(2-phenylethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 59836330) has the molecular formula C32H38FN3O and a molecular weight of 499.67 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-7-(2-phenylethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-7-(2-phenylethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 59836330 |
| Molecular Formula | C32H38FN3O |
| Molecular Weight | 499.67 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 1-(4-fluorophenyl)-7-(2-phenylethyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2CCc1ccccc1 |
| InChI | InChI=1S/C32H38FN3O/c1-31(2)23-18-19-32(3,20-23)30(31)34-29(37)27-26-11-7-10-22(13-12-21-8-5-4-6-9-21)28(26)36(35-27)25-16-14-24(33)15-17-25/h4-6,8-9,14-17,22-23,30H,7,10-13,18-20H2,1-3H3,(H,34,37) |
| InChIKey | ZRUCMPFWCHAXET-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |