C24H30FN3O — CID 163462572
1-(3-fluorophenyl)-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 163462572) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 163462572 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC1(C)C2CC[C@@](C)(C2)C1NC(=O)c1nn(-c2cccc(F)c2)c2c1CCCC2 |
| InChI | InChI=1S/C24H30FN3O/c1-23(2)15-11-12-24(3,14-15)22(23)26-21(29)20-18-9-4-5-10-19(18)28(27-20)17-8-6-7-16(25)13-17/h6-8,13,15,22H,4-5,9-12,14H2,1-3H3,(H,26,29)/t15?,22?,24-/m0/s1 |
| InChIKey | BPWCBEJMEVJKPM-IKQVNCIXSA-N |
| XLogP | 4.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |