C25H33N3O2 — CID 59836485
1-(4-methoxyphenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 59836485) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 59836485 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NC3C4(C)CCC(C4)C3(C)C)c3c2CCCC3)cc1 |
| InChI | InChI=1S/C25H33N3O2/c1-24(2)16-13-14-25(3,15-16)23(24)26-22(29)21-19-7-5-6-8-20(19)28(27-21)17-9-11-18(30-4)12-10-17/h9-12,16,23H,5-8,13-15H2,1-4H3,(H,26,29) |
| InChIKey | XVSQHLOIYMJZKI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |