C24H30ClN3O — CID 59836226
1-(4-chlorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 59836226) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 59836226 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1nn(-c2ccc(Cl)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C24H30ClN3O/c1-23(2)15-12-13-24(3,14-15)22(23)26-21(29)20-18-6-4-5-7-19(18)28(27-20)17-10-8-16(25)9-11-17/h8-11,15,22H,4-7,12-14H2,1-3H3,(H,26,29) |
| InChIKey | RMHFTJHRLKKPGF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |