C31H36F3N3O2 — CID 143431316
1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide;ethane (PubChem CID 143431316) has the molecular formula C31H36F3N3O2 and a molecular weight of 539.64 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide;ethane.
| Compound Name | 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143431316 |
| Molecular Formula | C31H36F3N3O2 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide;ethane |
| SMILES | C=CC(=C)[C@@H](CO)NC(=O)c1nn(-c2ccc(F)cc2F)c2c1CCCCC2CC1=CCC=CC(F)=C1.CC |
| InChI | InChI=1S/C29H30F3N3O2.C2H6/c1-3-18(2)25(17-36)33-29(37)27-23-11-7-5-9-20(14-19-8-4-6-10-21(30)15-19)28(23)35(34-27)26-13-12-22(31)16-24(26)32;1-2/h3,6,8,10,12-13,15-16,20,25,36H,1-2,4-5,7,9,11,14,17H2,(H,33,37);1-2H3/t20?,25-;/m1./s1 |
| InChIKey | CRTHGZMQQTYORI-RNJMRQNMSA-N |
| XLogP | 6.95 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|