C29H30F3N3O2 — CID 143431317
1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide (PubChem CID 143431317) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143431317 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 1-(2,4-difluorophenyl)-8-[(6-fluorocyclohepta-1,4,6-trien-1-yl)methyl]-N-[(2S)-1-hydroxy-3-methylidenepent-4-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazole-3-carboxamide |
| SMILES | C=CC(=C)[C@@H](CO)NC(=O)c1nn(-c2ccc(F)cc2F)c2c1CCCCC2CC1=CCC=CC(F)=C1 |
| InChI | InChI=1S/C29H30F3N3O2/c1-3-18(2)25(17-36)33-29(37)27-23-11-7-5-9-20(14-19-8-4-6-10-21(30)15-19)28(23)35(34-27)26-13-12-22(31)16-24(26)32/h3,6,8,10,12-13,15-16,20,25,36H,1-2,4-5,7,9,11,14,17H2,(H,33,37)/t20?,25-/m1/s1 |
| InChIKey | BASBSCQXJNGECR-GBAXHLBXSA-N |
| XLogP | 5.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|