C15H15FN2O3S2 — CID 87590482
(E)-2-[7-[(3-fluorophenyl)methyl]-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-yl]ethenesulfonic acid (PubChem CID 87590482) has the molecular formula C15H15FN2O3S2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (E)-2-[7-[(3-fluorophenyl)methyl]-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-yl]ethenesulfonic acid.
| Compound Name | (E)-2-[7-[(3-fluorophenyl)methyl]-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-yl]ethenesulfonic acid |
|---|---|
| PubChem CID | 87590482 |
| Molecular Formula | C15H15FN2O3S2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (E)-2-[7-[(3-fluorophenyl)methyl]-1,4,6,7-tetrahydrothiopyrano[4,3-c]pyrazol-3-yl]ethenesulfonic acid |
| SMILES | O=S(=O)(O)/C=C/c1n[nH]c2c1CSCC2Cc1cccc(F)c1 |
| InChI | InChI=1S/C15H15FN2O3S2/c16-12-3-1-2-10(7-12)6-11-8-22-9-13-14(17-18-15(11)13)4-5-23(19,20)21/h1-5,7,11H,6,8-9H2,(H,17,18)(H,19,20,21)/b5-4+ |
| InChIKey | UHMOCUNGVFPLAP-SNAWJCMRSA-N |
| XLogP | 2.98 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|