C24H33NO6 — CID 143307631
ethane;N-formyl-3-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methoxyphenyl)methyl]cyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 143307631) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is ethane;N-formyl-3-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methoxyphenyl)methyl]cyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | ethane;N-formyl-3-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methoxyphenyl)methyl]cyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 143307631 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | ethane;N-formyl-3-[2-(2-methoxyethoxy)ethoxy]-N-[(4-methoxyphenyl)methyl]cyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CC.COCCOCCOC1=CC=CCC(C(=O)N(C=O)Cc2ccc(OC)cc2)=C1 |
| InChI | InChI=1S/C22H27NO6.C2H6/c1-26-11-12-28-13-14-29-21-6-4-3-5-19(15-21)22(25)23(17-24)16-18-7-9-20(27-2)10-8-18;1-2/h3-4,6-10,15,17H,5,11-14,16H2,1-2H3;1-2H3 |
| InChIKey | QTRXHWSUXLKIOR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|