About N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine
N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine (PubChem CID 143309254) has the molecular formula C27H38N2
and a molecular weight of 390.62 g/mol. Its IUPAC name is N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine.
Molecular Properties
| Compound Name | N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine |
| PubChem CID | 143309254 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine |
| SMILES | C=C(CCc1ccc(C)cc1)NCNc1ccc(C(CCCCC)=C(C)C)cc1 |
| InChI | InChI=1S/C27H38N2/c1-6-7-8-9-27(21(2)3)25-16-18-26(19-17-25)29-20-28-23(5)12-15-24-13-10-22(4)11-14-24/h10-11,13-14,16-19,28-29H,5-9,12,15,20H2,1-4H3 |
| InChIKey | RQMUZBZJMOJDMU-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine?
The IUPAC name of N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine (CID 143309254) is N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine.
What is the SMILES notation for N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine?
The canonical SMILES for N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine is C=C(CCc1ccc(C)cc1)NCNc1ccc(C(CCCCC)=C(C)C)cc1.
What is the InChIKey of N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine?
The InChIKey is RQMUZBZJMOJDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38N2/c1-6-7-8-9-27(21(2)3)25-16-18-26(19-17-25)29-20-28-23(5)12-15-24-13-10-22(4)11-14-24/h10-11,13-14,16-19,28-29H,5-9,12,15,20H2,1-4H3.
What are the key properties of N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine?
N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine has a molecular weight of 390.62 g/mol, XLogP of 7.47, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-methyloct-2-en-3-yl)phenyl]-N'-[4-(4-methylphenyl)but-1-en-2-yl]methanediamine is sourced from PubChem (CID 143309254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).