C22H25IN3O4S- — CID 143310474
CID 143310474 (PubChem CID 143310474) has the molecular formula C22H25IN3O4S- and a molecular weight of 554.43 g/mol.
| Compound Name | CID 143310474 |
|---|---|
| PubChem CID | 143310474 |
| Molecular Formula | C22H25IN3O4S- |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | — |
| SMILES | Cc1c(OCC2CCC3(CC2)OC[I-]O3)ccnc1CS(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H25IN3O4S/c1-15-19(13-31(27)21-25-17-4-2-3-5-18(17)26-21)24-11-8-20(15)28-12-16-6-9-22(10-7-16)29-14-23-30-22/h2-5,8,11,16H,6-7,9-10,12-14H2,1H3,(H,25,26)/q-1 |
| InChIKey | FIVLOHDJQBALDH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|