C24H25FN4O3 — CID 143310867
2-[5-[(5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-oxoacetaldehyde (PubChem CID 143310867) has the molecular formula C24H25FN4O3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[5-[(5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[5-[(5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 143310867 |
| Molecular Formula | C24H25FN4O3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[5-[(5S)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazine-1-carbonyl]-6-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-oxoacetaldehyde |
| SMILES | Cc1nc2[nH]cc(C(=O)C=O)c2cc1C(=O)N1C[C@H](C)N(Cc2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C24H25FN4O3/c1-14-11-29(15(2)10-28(14)12-17-4-6-18(25)7-5-17)24(32)19-8-20-21(22(31)13-30)9-26-23(20)27-16(19)3/h4-9,13-15H,10-12H2,1-3H3,(H,26,27)/t14-,15?/m0/s1 |
| InChIKey | SVQNCMVPBLWGBC-MLCCFXAWSA-N |
| XLogP | 3.13 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|