C26H31FN2O — CID 143311705
2-[5-[2-(3-fluoro-4-methoxyphenyl)-3-methyl-1H-indol-5-yl]cyclohepten-1-yl]-N-methylethanamine (PubChem CID 143311705) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[5-[2-(3-fluoro-4-methoxyphenyl)-3-methyl-1H-indol-5-yl]cyclohepten-1-yl]-N-methylethanamine.
| Compound Name | 2-[5-[2-(3-fluoro-4-methoxyphenyl)-3-methyl-1H-indol-5-yl]cyclohepten-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 143311705 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[5-[2-(3-fluoro-4-methoxyphenyl)-3-methyl-1H-indol-5-yl]cyclohepten-1-yl]-N-methylethanamine |
| SMILES | CNCCC1=CCCC(c2ccc3[nH]c(-c4ccc(OC)c(F)c4)c(C)c3c2)CC1 |
| InChI | InChI=1S/C26H31FN2O/c1-17-22-15-20(19-6-4-5-18(7-8-19)13-14-28-2)9-11-24(22)29-26(17)21-10-12-25(30-3)23(27)16-21/h5,9-12,15-16,19,28-29H,4,6-8,13-14H2,1-3H3 |
| InChIKey | BJCSGSBUKLSABO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|