C29H46ClN3O3 — CID 143312612
(3E,6Z)-4-[4-[5-chloro-2-(methylamino)phenyl]-1-formyl-3,6-dihydro-2H-pyridin-6-yl]-N,N,2-trimethylocta-3,6-dienamide;ethane;methoxyethane (PubChem CID 143312612) has the molecular formula C29H46ClN3O3 and a molecular weight of 520.16 g/mol. Its IUPAC name is (3E,6Z)-4-[4-[5-chloro-2-(methylamino)phenyl]-1-formyl-3,6-dihydro-2H-pyridin-6-yl]-N,N,2-trimethylocta-3,6-dienamide;ethane;methoxyethane.
| Compound Name | (3E,6Z)-4-[4-[5-chloro-2-(methylamino)phenyl]-1-formyl-3,6-dihydro-2H-pyridin-6-yl]-N,N,2-trimethylocta-3,6-dienamide;ethane;methoxyethane |
|---|---|
| PubChem CID | 143312612 |
| Molecular Formula | C29H46ClN3O3 |
| Molecular Weight | 520.16 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | (3E,6Z)-4-[4-[5-chloro-2-(methylamino)phenyl]-1-formyl-3,6-dihydro-2H-pyridin-6-yl]-N,N,2-trimethylocta-3,6-dienamide;ethane;methoxyethane |
| SMILES | C/C=C\C/C(=C\C(C)C(=O)N(C)C)C1C=C(c2cc(Cl)ccc2NC)CCN1C=O.CC.CCOC |
| InChI | InChI=1S/C24H32ClN3O2.C3H8O.C2H6/c1-6-7-8-19(13-17(2)24(30)27(4)5)23-14-18(11-12-28(23)16-29)21-15-20(25)9-10-22(21)26-3;1-3-4-2;1-2/h6-7,9-10,13-17,23,26H,8,11-12H2,1-5H3;3H2,1-2H3;1-2H3/b7-6-,19-13+;; |
| InChIKey | VXPQGCFIHHDZBK-JAPLWQRDSA-N |
| XLogP | 6.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.16 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|