C22H26ClN3O3 — CID 143111247
4-[2-[amino(methyl)amino]-5-chlorophenyl]-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 143111247) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-[2-[amino(methyl)amino]-5-chlorophenyl]-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde.
| Compound Name | 4-[2-[amino(methyl)amino]-5-chlorophenyl]-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 143111247 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-[2-[amino(methyl)amino]-5-chlorophenyl]-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | COCCOc1ccc(C2C=C(c3cc(Cl)ccc3N(C)N)CCN2C=O)cc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-25(24)21-8-5-18(23)14-20(21)17-9-10-26(15-27)22(13-17)16-3-6-19(7-4-16)29-12-11-28-2/h3-8,13-15,22H,9-12,24H2,1-2H3 |
| InChIKey | MQFZYQBNGITGMT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|