C25H32N2O4 — CID 143312591
propyl 4-(2-amino-5-methylphenyl)-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 143312591) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is propyl 4-(2-amino-5-methylphenyl)-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | propyl 4-(2-amino-5-methylphenyl)-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 143312591 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | propyl 4-(2-amino-5-methylphenyl)-6-[4-(2-methoxyethoxy)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCCOC(=O)N1CCC(c2cc(C)ccc2N)=CC1c1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-4-13-31-25(28)27-12-11-20(22-16-18(2)5-10-23(22)26)17-24(27)19-6-8-21(9-7-19)30-15-14-29-3/h5-10,16-17,24H,4,11-15,26H2,1-3H3 |
| InChIKey | FINIGANGQMSXDK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|