C31H54Cl2N4O6 — CID 143314815
dichloromethane;N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-1-formylpyrrolidine-2-carboxamide;3-methylpentan-2-yl N-(1-cyclohexylethyl)carbamate (PubChem CID 143314815) has the molecular formula C31H54Cl2N4O6 and a molecular weight of 649.70 g/mol. Its IUPAC name is dichloromethane;N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-1-formylpyrrolidine-2-carboxamide;3-methylpentan-2-yl N-(1-cyclohexylethyl)carbamate.
| Compound Name | dichloromethane;N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-1-formylpyrrolidine-2-carboxamide;3-methylpentan-2-yl N-(1-cyclohexylethyl)carbamate |
|---|---|
| PubChem CID | 143314815 |
| Molecular Formula | C31H54Cl2N4O6 |
| Molecular Weight | 649.70 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | dichloromethane;N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]-1-formylpyrrolidine-2-carboxamide;3-methylpentan-2-yl N-(1-cyclohexylethyl)carbamate |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CCCN1C=O.CCC(C)C(C)OC(=O)NC(C)C1CCCCC1.ClCCl |
| InChI | InChI=1S/C15H23N3O4.C15H29NO2.CH2Cl2/c1-3-6-11(13(20)15(22)16-8-4-2)17-14(21)12-7-5-9-18(12)10-19;1-5-11(2)13(4)18-15(17)16-12(3)14-9-7-6-8-10-14;2-1-3/h4,10-12H,2-3,5-9H2,1H3,(H,16,22)(H,17,21);11-14H,5-10H2,1-4H3,(H,16,17);1H2 |
| InChIKey | DJJNENZTUUVXIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|