C16H27NO2 — CID 143314881
(1S)-1-methyl-2-[(Z,8S)-8-methyl-9-oxodec-1-enyl]cyclopropane-1-carboxamide (PubChem CID 143314881) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (1S)-1-methyl-2-[(Z,8S)-8-methyl-9-oxodec-1-enyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-1-methyl-2-[(Z,8S)-8-methyl-9-oxodec-1-enyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143314881 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (1S)-1-methyl-2-[(Z,8S)-8-methyl-9-oxodec-1-enyl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)[C@@H](C)CCCCC/C=C\C1C[C@]1(C)C(N)=O |
| InChI | InChI=1S/C16H27NO2/c1-12(13(2)18)9-7-5-4-6-8-10-14-11-16(14,3)15(17)19/h8,10,12,14H,4-7,9,11H2,1-3H3,(H2,17,19)/b10-8-/t12-,14?,16-/m0/s1 |
| InChIKey | YSKCFTDMWRJCFC-XXIRPIODSA-N |
| XLogP | 3.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|