C25H40N4O4 — CID 143315426
(3R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-2-methyl-3-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 143315426) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is (3R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-2-methyl-3-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (3R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-2-methyl-3-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143315426 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (3R)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hept-6-yn-3-yl]-2-methyl-3-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1(C)[C@@H](C(C)C)CCN1C(=O)[C@@H](N)C(C)(C)C)C(=O)C(=O)NCC=C |
| InChI | InChI=1S/C25H40N4O4/c1-9-11-12-18(19(30)21(31)27-14-10-2)28-23(33)25(8)17(16(3)4)13-15-29(25)22(32)20(26)24(5,6)7/h1,10,16-18,20H,2,11-15,26H2,3-8H3,(H,27,31)(H,28,33)/t17-,18?,20-,25?/m1/s1 |
| InChIKey | HGXUDAMKQVUKEE-HTYOSTMBSA-N |
| XLogP | 1.39 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|