C19H26N4O3S — CID 143316009
4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide (PubChem CID 143316009) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide.
| Compound Name | 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide |
|---|---|
| PubChem CID | 143316009 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[amino(3,3-dimethylbutanoyl)amino]-N-(3-ethyl-1,3-thiazol-2-ylidene)-3-methoxybenzamide |
| SMILES | CCn1ccs/c1=N/C(=O)c1ccc(N(N)C(=O)CC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H26N4O3S/c1-6-22-9-10-27-18(22)21-17(25)13-7-8-14(15(11-13)26-5)23(20)16(24)12-19(2,3)4/h7-11H,6,12,20H2,1-5H3/b21-18+ |
| InChIKey | LKUKVBFRGPLDQV-DYTRJAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|