C21H23FN2O3 — CID 143317395
benzyl N-[(Z)-3-amino-1-(5-fluoro-2-propylphenyl)-2-methyl-3-oxoprop-1-enyl]carbamate (PubChem CID 143317395) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is benzyl N-[(Z)-3-amino-1-(5-fluoro-2-propylphenyl)-2-methyl-3-oxoprop-1-enyl]carbamate.
| Compound Name | benzyl N-[(Z)-3-amino-1-(5-fluoro-2-propylphenyl)-2-methyl-3-oxoprop-1-enyl]carbamate |
|---|---|
| PubChem CID | 143317395 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | benzyl N-[(Z)-3-amino-1-(5-fluoro-2-propylphenyl)-2-methyl-3-oxoprop-1-enyl]carbamate |
| SMILES | CCCc1ccc(F)cc1/C(NC(=O)OCc1ccccc1)=C(\C)C(N)=O |
| InChI | InChI=1S/C21H23FN2O3/c1-3-7-16-10-11-17(22)12-18(16)19(14(2)20(23)25)24-21(26)27-13-15-8-5-4-6-9-15/h4-6,8-12H,3,7,13H2,1-2H3,(H2,23,25)(H,24,26)/b19-14- |
| InChIKey | KHFHNGBXZBKJND-RGEXLXHISA-N |
| XLogP | 3.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|