C17H13F2NO4 — CID 69131840
3-(2,5-difluorophenyl)-3-(phenylmethoxycarbonylamino)prop-2-enoic acid (PubChem CID 69131840) has the molecular formula C17H13F2NO4 and a molecular weight of 333.29 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-3-(phenylmethoxycarbonylamino)prop-2-enoic acid.
| Compound Name | 3-(2,5-difluorophenyl)-3-(phenylmethoxycarbonylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 69131840 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-(2,5-difluorophenyl)-3-(phenylmethoxycarbonylamino)prop-2-enoic acid |
| SMILES | O=C(O)C=C(NC(=O)OCc1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H13F2NO4/c18-12-6-7-14(19)13(8-12)15(9-16(21)22)20-17(23)24-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,20,23)(H,21,22) |
| InChIKey | REHAUQBJPRVDCK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|