C22H44O3 — CID 143318262
methane;(E,5S,6R,7S,8R)-6-methoxy-5,7,8-trimethyl-10-[(Z,4R)-4-methylhex-2-enyl]peroxydec-2-ene (PubChem CID 143318262) has the molecular formula C22H44O3 and a molecular weight of 356.59 g/mol. Its IUPAC name is methane;(E,5S,6R,7S,8R)-6-methoxy-5,7,8-trimethyl-10-[(Z,4R)-4-methylhex-2-enyl]peroxydec-2-ene.
| Compound Name | methane;(E,5S,6R,7S,8R)-6-methoxy-5,7,8-trimethyl-10-[(Z,4R)-4-methylhex-2-enyl]peroxydec-2-ene |
|---|---|
| PubChem CID | 143318262 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | methane;(E,5S,6R,7S,8R)-6-methoxy-5,7,8-trimethyl-10-[(Z,4R)-4-methylhex-2-enyl]peroxydec-2-ene |
| SMILES | C.C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@H](C)CCOOC/C=C\[C@H](C)CC |
| InChI | InChI=1S/C21H40O3.CH4/c1-8-10-13-19(5)21(22-7)20(6)18(4)14-16-24-23-15-11-12-17(3)9-2;/h8,10-12,17-21H,9,13-16H2,1-7H3;1H4/b10-8+,12-11-;/t17-,18-,19+,20+,21-;/m1./s1 |
| InChIKey | HXYOQKRJFLVRKK-LQTUPADOSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|