C20H40O2 — CID 150096400
4-methoxy-7-(2-methoxypropan-2-yl)pentadec-2-ene (PubChem CID 150096400) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 4-methoxy-7-(2-methoxypropan-2-yl)pentadec-2-ene.
| Compound Name | 4-methoxy-7-(2-methoxypropan-2-yl)pentadec-2-ene |
|---|---|
| PubChem CID | 150096400 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 4-methoxy-7-(2-methoxypropan-2-yl)pentadec-2-ene |
| SMILES | CC=CC(CCC(CCCCCCCC)C(C)(C)OC)OC |
| InChI | InChI=1S/C20H40O2/c1-7-9-10-11-12-13-15-18(20(3,4)22-6)16-17-19(21-5)14-8-2/h8,14,18-19H,7,9-13,15-17H2,1-6H3 |
| InChIKey | DUIDIGRDWDTNPF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|