C24H30FN3O3S2 — CID 143320558
(E)-but-2-ene;2,3-dimethoxyprop-1-ene;2-[4-(4-fluorophenyl)-2-methyl-1,3-thiazol-5-yl]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 143320558) has the molecular formula C24H30FN3O3S2 and a molecular weight of 491.65 g/mol. Its IUPAC name is (E)-but-2-ene;2,3-dimethoxyprop-1-ene;2-[4-(4-fluorophenyl)-2-methyl-1,3-thiazol-5-yl]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | (E)-but-2-ene;2,3-dimethoxyprop-1-ene;2-[4-(4-fluorophenyl)-2-methyl-1,3-thiazol-5-yl]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 143320558 |
| Molecular Formula | C24H30FN3O3S2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (E)-but-2-ene;2,3-dimethoxyprop-1-ene;2-[4-(4-fluorophenyl)-2-methyl-1,3-thiazol-5-yl]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | C/C=C/C.C=C(COC)OC.CNC(=O)c1csc(-c2sc(C)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H12FN3OS2.C5H10O2.C4H8/c1-8-18-12(9-3-5-10(16)6-4-9)13(22-8)15-19-11(7-21-15)14(20)17-2;1-5(7-3)4-6-2;1-3-4-2/h3-7H,1-2H3,(H,17,20);1,4H2,2-3H3;3-4H,1-2H3/b;;4-3+ |
| InChIKey | PWEAPULMBTWKNX-VJJINTEWSA-N |
| XLogP | 6.12 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|