C21H17F3N4 — CID 143320837
N-(2-methanimidoyl-2,3-dihydro-1H-inden-5-yl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 143320837) has the molecular formula C21H17F3N4 and a molecular weight of 382.39 g/mol. Its IUPAC name is N-(2-methanimidoyl-2,3-dihydro-1H-inden-5-yl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | N-(2-methanimidoyl-2,3-dihydro-1H-inden-5-yl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 143320837 |
| Molecular Formula | C21H17F3N4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(2-methanimidoyl-2,3-dihydro-1H-inden-5-yl)-6-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | [H]/N=C/C1Cc2ccc(Nc3cc(-c4ccc(C(F)(F)F)cc4)ncn3)cc2C1 |
| InChI | InChI=1S/C21H17F3N4/c22-21(23,24)17-4-1-14(2-5-17)19-10-20(27-12-26-19)28-18-6-3-15-7-13(11-25)8-16(15)9-18/h1-6,9-13,25H,7-8H2,(H,26,27,28)/b25-11+ |
| InChIKey | YAHPBIYALCVEGA-OPEKNORGSA-N |
| XLogP | 5.27 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|