C21H26ClNO5P2 — CID 143322543
methyl 4-[1-[(2E)-2-[(E)-1,3-bis(phosphanyloxy)prop-1-enyl]-4-chloropenta-2,4-dienoyl]pyrrolidin-2-yl]-3-methylbenzoate (PubChem CID 143322543) has the molecular formula C21H26ClNO5P2 and a molecular weight of 469.84 g/mol. Its IUPAC name is methyl 4-[1-[(2E)-2-[(E)-1,3-bis(phosphanyloxy)prop-1-enyl]-4-chloropenta-2,4-dienoyl]pyrrolidin-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[1-[(2E)-2-[(E)-1,3-bis(phosphanyloxy)prop-1-enyl]-4-chloropenta-2,4-dienoyl]pyrrolidin-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 143322543 |
| Molecular Formula | C21H26ClNO5P2 |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | methyl 4-[1-[(2E)-2-[(E)-1,3-bis(phosphanyloxy)prop-1-enyl]-4-chloropenta-2,4-dienoyl]pyrrolidin-2-yl]-3-methylbenzoate |
| SMILES | C=C(Cl)/C=C(C(=O)N1CCCC1c1ccc(C(=O)OC)cc1C)\C(=C/COP)OP |
| InChI | InChI=1S/C21H26ClNO5P2/c1-13-11-15(21(25)26-3)6-7-16(13)18-5-4-9-23(18)20(24)17(12-14(2)22)19(28-30)8-10-27-29/h6-8,11-12,18H,2,4-5,9-10,29-30H2,1,3H3/b17-12+,19-8+ |
| InChIKey | HVYNUESZUKHWID-SPDWQDPISA-N |
| XLogP | 4.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|