C21H23NO4 — CID 143664593
methyl 4-[1-(4-hydroxy-3-methylbenzoyl)pyrrolidin-2-yl]-3-methylbenzoate (PubChem CID 143664593) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 4-[1-(4-hydroxy-3-methylbenzoyl)pyrrolidin-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[1-(4-hydroxy-3-methylbenzoyl)pyrrolidin-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 143664593 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 4-[1-(4-hydroxy-3-methylbenzoyl)pyrrolidin-2-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(C2CCCN2C(=O)c2ccc(O)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C21H23NO4/c1-13-11-16(21(25)26-3)6-8-17(13)18-5-4-10-22(18)20(24)15-7-9-19(23)14(2)12-15/h6-9,11-12,18,23H,4-5,10H2,1-3H3 |
| InChIKey | MPAZPCCXNPWAJH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |