C10H17FN4S — CID 143323973
5-[2-(dimethylamino)ethyl]-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-amine (PubChem CID 143323973) has the molecular formula C10H17FN4S and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethyl]-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-amine.
| Compound Name | 5-[2-(dimethylamino)ethyl]-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 143323973 |
| Molecular Formula | C10H17FN4S |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 5-[2-(dimethylamino)ethyl]-4-fluoro-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-amine |
| SMILES | CN(C)CCN1CCc2sc(N)nc2C1F |
| InChI | InChI=1S/C10H17FN4S/c1-14(2)5-6-15-4-3-7-8(9(15)11)13-10(12)16-7/h9H,3-6H2,1-2H3,(H2,12,13) |
| InChIKey | WZFLMPZUEZHBQR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|