C26H39NO4S — CID 143324505
methyl 5-(cyclohexen-1-yl)-3-[[(E)-1-hydroxy-2,5-dimethylhex-3-enyl]-[(E)-5-hydroxyhex-3-en-2-yl]amino]thiophene-2-carboxylate (PubChem CID 143324505) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is methyl 5-(cyclohexen-1-yl)-3-[[(E)-1-hydroxy-2,5-dimethylhex-3-enyl]-[(E)-5-hydroxyhex-3-en-2-yl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(cyclohexen-1-yl)-3-[[(E)-1-hydroxy-2,5-dimethylhex-3-enyl]-[(E)-5-hydroxyhex-3-en-2-yl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 143324505 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | methyl 5-(cyclohexen-1-yl)-3-[[(E)-1-hydroxy-2,5-dimethylhex-3-enyl]-[(E)-5-hydroxyhex-3-en-2-yl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(C2=CCCCC2)cc1N(C(C)/C=C/C(C)O)C(O)C(C)/C=C/C(C)C |
| InChI | InChI=1S/C26H39NO4S/c1-17(2)12-13-18(3)25(29)27(19(4)14-15-20(5)28)22-16-23(21-10-8-7-9-11-21)32-24(22)26(30)31-6/h10,12-20,25,28-29H,7-9,11H2,1-6H3/b13-12+,15-14+ |
| InChIKey | BARIBRLTOJHFKH-SQIWNDBBSA-N |
| XLogP | 5.79 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|