C21H32N4O2S — CID 143324689
methyl 5-(cyclohexen-1-yl)-3-[1-[(methylideneamino)-(methyliminomethyl)amino]hexan-3-ylamino]thiophene-2-carboxylate (PubChem CID 143324689) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is methyl 5-(cyclohexen-1-yl)-3-[1-[(methylideneamino)-(methyliminomethyl)amino]hexan-3-ylamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-(cyclohexen-1-yl)-3-[1-[(methylideneamino)-(methyliminomethyl)amino]hexan-3-ylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 143324689 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 5-(cyclohexen-1-yl)-3-[1-[(methylideneamino)-(methyliminomethyl)amino]hexan-3-ylamino]thiophene-2-carboxylate |
| SMILES | C=NN(/C=N/C)CCC(CCC)Nc1cc(C2=CCCCC2)sc1C(=O)OC |
| InChI | InChI=1S/C21H32N4O2S/c1-5-9-17(12-13-25(23-3)15-22-2)24-18-14-19(16-10-7-6-8-11-16)28-20(18)21(26)27-4/h10,14-15,17,24H,3,5-9,11-13H2,1-2,4H3/b22-15+ |
| InChIKey | DIDJIXOKAASHBW-PXLXIMEGSA-N |
| XLogP | 5.04 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|