About 2,4-dimethylthiophene;vanadium
2,4-dimethylthiophene;vanadium (PubChem CID 143324996) has the molecular formula C6H8SV
and a molecular weight of 163.14 g/mol. Its IUPAC name is 2,4-dimethylthiophene;vanadium.
Molecular Properties
| Compound Name | 2,4-dimethylthiophene;vanadium |
| PubChem CID | 143324996 |
| Molecular Formula | C6H8SV |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 162.98 |
| IUPAC Name | 2,4-dimethylthiophene;vanadium |
| SMILES | Cc1csc(C)c1.[V] |
| InChI | InChI=1S/C6H8S.V/c1-5-3-6(2)7-4-5;/h3-4H,1-2H3; |
| InChIKey | CWBBZVMNCGEZSW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylthiophene;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylthiophene;vanadium?
The IUPAC name of 2,4-dimethylthiophene;vanadium (CID 143324996) is 2,4-dimethylthiophene;vanadium.
What is the SMILES notation for 2,4-dimethylthiophene;vanadium?
The canonical SMILES for 2,4-dimethylthiophene;vanadium is Cc1csc(C)c1.[V].
What is the InChIKey of 2,4-dimethylthiophene;vanadium?
The InChIKey is CWBBZVMNCGEZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8S.V/c1-5-3-6(2)7-4-5;/h3-4H,1-2H3;.
What are the key properties of 2,4-dimethylthiophene;vanadium?
2,4-dimethylthiophene;vanadium has a molecular weight of 163.14 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylthiophene;vanadium is sourced from PubChem (CID 143324996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).