C6H8SV — CID 143324996
2,4-dimethylthiophene;vanadium (PubChem CID 143324996) has the molecular formula C6H8SV and a molecular weight of 163.14 g/mol. Its IUPAC name is 2,4-dimethylthiophene;vanadium.
| Compound Name | 2,4-dimethylthiophene;vanadium |
|---|---|
| PubChem CID | 143324996 |
| Molecular Formula | C6H8SV |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 162.98 |
| IUPAC Name | 2,4-dimethylthiophene;vanadium |
| SMILES | Cc1csc(C)c1.[V] |
| InChI | InChI=1S/C6H8S.V/c1-5-3-6(2)7-4-5;/h3-4H,1-2H3; |
| InChIKey | CWBBZVMNCGEZSW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |