C13H15NO2S — CID 175534034
2,4-dimethylthiophene;phenylcarbamic acid (PubChem CID 175534034) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 2,4-dimethylthiophene;phenylcarbamic acid.
| Compound Name | 2,4-dimethylthiophene;phenylcarbamic acid |
|---|---|
| PubChem CID | 175534034 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2,4-dimethylthiophene;phenylcarbamic acid |
| SMILES | Cc1csc(C)c1.O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C6H8S/c9-7(10)8-6-4-2-1-3-5-6;1-5-3-6(2)7-4-5/h1-5,8H,(H,9,10);3-4H,1-2H3 |
| InChIKey | SYKCDYPMPPQSAQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |