About 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile
1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile (PubChem CID 143325289) has the molecular formula C21H45N
and a molecular weight of 311.60 g/mol. Its IUPAC name is 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile.
Molecular Properties
| Compound Name | 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile |
| PubChem CID | 143325289 |
| Molecular Formula | C21H45N |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 311.36 |
| IUPAC Name | 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile |
| SMILES | CC.CC.CCC(C)C1(C)CCC1.CCCCCCCC#N |
| InChI | InChI=1S/C9H18.C8H15N.2C2H6/c1-4-8(2)9(3)6-5-7-9;1-2-3-4-5-6-7-8-9;2*1-2/h8H,4-7H2,1-3H3;2-7H2,1H3;2*1-2H3 |
| InChIKey | DNCBTJZUGMVPML-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile?
The IUPAC name of 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile (CID 143325289) is 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile.
What is the SMILES notation for 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile?
The canonical SMILES for 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile is CC.CC.CCC(C)C1(C)CCC1.CCCCCCCC#N.
What is the InChIKey of 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile?
The InChIKey is DNCBTJZUGMVPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C8H15N.2C2H6/c1-4-8(2)9(3)6-5-7-9;1-2-3-4-5-6-7-8-9;2*1-2/h8H,4-7H2,1-3H3;2-7H2,1H3;2*1-2H3.
What are the key properties of 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile?
1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile has a molecular weight of 311.60 g/mol, XLogP of 8.15, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-1-methylcyclobutane;ethane;octanenitrile is sourced from PubChem (CID 143325289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).