About 3,4-dimethylpentanenitrile;ethane;hexanenitrile
3,4-dimethylpentanenitrile;ethane;hexanenitrile (PubChem CID 176998790) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 3,4-dimethylpentanenitrile;ethane;hexanenitrile.
Molecular Properties
| Compound Name | 3,4-dimethylpentanenitrile;ethane;hexanenitrile |
| PubChem CID | 176998790 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 3,4-dimethylpentanenitrile;ethane;hexanenitrile |
| SMILES | CC.CC(C)C(C)CC#N.CCCCCC#N |
| InChI | InChI=1S/C7H13N.C6H11N.C2H6/c1-6(2)7(3)4-5-8;1-2-3-4-5-6-7;1-2/h6-7H,4H2,1-3H3;2-5H2,1H3;1-2H3 |
| InChIKey | FWQAYKPCPIVFFT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylpentanenitrile;ethane;hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylpentanenitrile;ethane;hexanenitrile?
The IUPAC name of 3,4-dimethylpentanenitrile;ethane;hexanenitrile (CID 176998790) is 3,4-dimethylpentanenitrile;ethane;hexanenitrile.
What is the SMILES notation for 3,4-dimethylpentanenitrile;ethane;hexanenitrile?
The canonical SMILES for 3,4-dimethylpentanenitrile;ethane;hexanenitrile is CC.CC(C)C(C)CC#N.CCCCCC#N.
What is the InChIKey of 3,4-dimethylpentanenitrile;ethane;hexanenitrile?
The InChIKey is FWQAYKPCPIVFFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C6H11N.C2H6/c1-6(2)7(3)4-5-8;1-2-3-4-5-6-7;1-2/h6-7H,4H2,1-3H3;2-5H2,1H3;1-2H3.
What are the key properties of 3,4-dimethylpentanenitrile;ethane;hexanenitrile?
3,4-dimethylpentanenitrile;ethane;hexanenitrile has a molecular weight of 238.42 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylpentanenitrile;ethane;hexanenitrile is sourced from PubChem (CID 176998790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).