About 1-isocyanooctane;8-isocyanooctanenitrile
1-isocyanooctane;8-isocyanooctanenitrile (PubChem CID 161128912) has the molecular formula C18H31N3
and a molecular weight of 289.47 g/mol. Its IUPAC name is 1-isocyanooctane;8-isocyanooctanenitrile.
Molecular Properties
| Compound Name | 1-isocyanooctane;8-isocyanooctanenitrile |
| PubChem CID | 161128912 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 1-isocyanooctane;8-isocyanooctanenitrile |
| SMILES | [C-]#[N+]CCCCCCCC.[C-]#[N+]CCCCCCCC#N |
| InChI | InChI=1S/C9H14N2.C9H17N/c1-11-9-7-5-3-2-4-6-8-10;1-3-4-5-6-7-8-9-10-2/h2-7,9H2;3-9H2,1H3 |
| InChIKey | ULXPZBYDZDERNT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanooctane;8-isocyanooctanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanooctane;8-isocyanooctanenitrile?
The IUPAC name of 1-isocyanooctane;8-isocyanooctanenitrile (CID 161128912) is 1-isocyanooctane;8-isocyanooctanenitrile.
What is the SMILES notation for 1-isocyanooctane;8-isocyanooctanenitrile?
The canonical SMILES for 1-isocyanooctane;8-isocyanooctanenitrile is [C-]#[N+]CCCCCCCC.[C-]#[N+]CCCCCCCC#N.
What is the InChIKey of 1-isocyanooctane;8-isocyanooctanenitrile?
The InChIKey is ULXPZBYDZDERNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C9H17N/c1-11-9-7-5-3-2-4-6-8-10;1-3-4-5-6-7-8-9-10-2/h2-7,9H2;3-9H2,1H3.
What are the key properties of 1-isocyanooctane;8-isocyanooctanenitrile?
1-isocyanooctane;8-isocyanooctanenitrile has a molecular weight of 289.47 g/mol, XLogP of 6.04, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanooctane;8-isocyanooctanenitrile is sourced from PubChem (CID 161128912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).