C19H24O3 — CID 143325760
4-[2-[4-(2-hydroxypropan-2-yl)phenoxy]butan-2-yl]phenol (PubChem CID 143325760) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[2-[4-(2-hydroxypropan-2-yl)phenoxy]butan-2-yl]phenol.
| Compound Name | 4-[2-[4-(2-hydroxypropan-2-yl)phenoxy]butan-2-yl]phenol |
|---|---|
| PubChem CID | 143325760 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 4-[2-[4-(2-hydroxypropan-2-yl)phenoxy]butan-2-yl]phenol |
| SMILES | CCC(C)(Oc1ccc(C(C)(C)O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H24O3/c1-5-19(4,15-6-10-16(20)11-7-15)22-17-12-8-14(9-13-17)18(2,3)21/h6-13,20-21H,5H2,1-4H3 |
| InChIKey | SLNRAQXVYZMVQY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |