C22H20NNaO6S — CID 143326086
sodium 4-[[5-[(5-methylfuran-2-yl)sulfinylmethylamino]-2,3-dihydro-1-benzofuran-6-yl]oxymethyl]benzoate (PubChem CID 143326086) has the molecular formula C22H20NNaO6S and a molecular weight of 449.46 g/mol. Its IUPAC name is sodium 4-[[5-[(5-methylfuran-2-yl)sulfinylmethylamino]-2,3-dihydro-1-benzofuran-6-yl]oxymethyl]benzoate.
| Compound Name | sodium 4-[[5-[(5-methylfuran-2-yl)sulfinylmethylamino]-2,3-dihydro-1-benzofuran-6-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 143326086 |
| Molecular Formula | C22H20NNaO6S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | sodium 4-[[5-[(5-methylfuran-2-yl)sulfinylmethylamino]-2,3-dihydro-1-benzofuran-6-yl]oxymethyl]benzoate |
| SMILES | Cc1ccc(S(=O)CNc2cc3c(cc2OCc2ccc(C(=O)[O-])cc2)OCC3)o1.[Na+] |
| InChI | InChI=1S/C22H21NO6S.Na/c1-14-2-7-21(29-14)30(26)13-23-18-10-17-8-9-27-19(17)11-20(18)28-12-15-3-5-16(6-4-15)22(24)25;/h2-7,10-11,23H,8-9,12-13H2,1H3,(H,24,25);/q;+1/p-1 |
| InChIKey | XWKHFZKRCBSDKF-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 100.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|