C15H17ClN4 — CID 143328515
5-benzyl-4-chloropyrrolo[3,2-d]pyrimidin-2-amine;ethane (PubChem CID 143328515) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 5-benzyl-4-chloropyrrolo[3,2-d]pyrimidin-2-amine;ethane.
| Compound Name | 5-benzyl-4-chloropyrrolo[3,2-d]pyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 143328515 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-benzyl-4-chloropyrrolo[3,2-d]pyrimidin-2-amine;ethane |
| SMILES | CC.Nc1nc(Cl)c2c(ccn2Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H11ClN4.C2H6/c14-12-11-10(16-13(15)17-12)6-7-18(11)8-9-4-2-1-3-5-9;1-2/h1-7H,8H2,(H2,15,16,17);1-2H3 |
| InChIKey | WHRNHKYQYSLWRW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |