C13H15F2NO2 — CID 143329580
5-(difluoromethyl)-1-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]pyridin-2-one (PubChem CID 143329580) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]pyridin-2-one.
| Compound Name | 5-(difluoromethyl)-1-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]pyridin-2-one |
|---|---|
| PubChem CID | 143329580 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-(difluoromethyl)-1-[(2Z,4E)-4-methoxyhexa-2,4-dienyl]pyridin-2-one |
| SMILES | C/C=C(\C=C/Cn1cc(C(F)F)ccc1=O)OC |
| InChI | InChI=1S/C13H15F2NO2/c1-3-11(18-2)5-4-8-16-9-10(13(14)15)6-7-12(16)17/h3-7,9,13H,8H2,1-2H3/b5-4-,11-3+ |
| InChIKey | JZUMVLUZEMSINP-NEPXUXLISA-N |
| XLogP | 2.89 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|