C10H14N4O — CID 143330703
ethane;N-methyl-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide (PubChem CID 143330703) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is ethane;N-methyl-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | ethane;N-methyl-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143330703 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | ethane;N-methyl-7H-pyrrolo[2,3-d]pyrimidine-4-carboxamide |
| SMILES | CC.CNC(=O)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C8H8N4O.C2H6/c1-9-8(13)6-5-2-3-10-7(5)12-4-11-6;1-2/h2-4H,1H3,(H,9,13)(H,10,11,12);1-2H3 |
| InChIKey | PMPDNFFRJSKCBR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |