C26H31N5O5S — CID 143330933
N-(oxan-2-yloxy)-2-[6-[[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]sulfonylamino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide (PubChem CID 143330933) has the molecular formula C26H31N5O5S and a molecular weight of 525.63 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-[6-[[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]sulfonylamino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-2-[6-[[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]sulfonylamino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143330933 |
| Molecular Formula | C26H31N5O5S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | N-(oxan-2-yloxy)-2-[6-[[4-[(1Z,3Z)-penta-1,3-dienyl]phenyl]sulfonylamino]-3-azabicyclo[3.1.0]hexan-3-yl]pyrimidine-5-carboxamide |
| SMILES | C/C=C\C=C/c1ccc(S(=O)(=O)NC2C3CN(c4ncc(C(=O)NOC5CCCCO5)cn4)CC32)cc1 |
| InChI | InChI=1S/C26H31N5O5S/c1-2-3-4-7-18-9-11-20(12-10-18)37(33,34)30-24-21-16-31(17-22(21)24)26-27-14-19(15-28-26)25(32)29-36-23-8-5-6-13-35-23/h2-4,7,9-12,14-15,21-24,30H,5-6,8,13,16-17H2,1H3,(H,29,32)/b3-2-,7-4- |
| InChIKey | BVYWCUXYJOSFRO-JXPISWCDSA-N |
| XLogP | 2.67 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|