About N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine
N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine (PubChem CID 143332504) has the molecular formula C10H25N3
and a molecular weight of 187.33 g/mol. Its IUPAC name is N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine.
Molecular Properties
| Compound Name | N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine |
| PubChem CID | 143332504 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine |
| SMILES | C=C(C)C(CC)CCNCN.CN |
| InChI | InChI=1S/C9H20N2.CH5N/c1-4-9(8(2)3)5-6-11-7-10;1-2/h9,11H,2,4-7,10H2,1,3H3;2H2,1H3 |
| InChIKey | MREBJXGKSKPKSV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine?
The IUPAC name of N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine (CID 143332504) is N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine.
What is the SMILES notation for N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine?
The canonical SMILES for N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine is C=C(C)C(CC)CCNCN.CN.
What is the InChIKey of N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine?
The InChIKey is MREBJXGKSKPKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.CH5N/c1-4-9(8(2)3)5-6-11-7-10;1-2/h9,11H,2,4-7,10H2,1,3H3;2H2,1H3.
What are the key properties of N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine?
N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine has a molecular weight of 187.33 g/mol, XLogP of 1.06, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-ethyl-4-methylpent-4-enyl)methanediamine;methanamine is sourced from PubChem (CID 143332504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).