C9H12N2 — CID 143332623
(4E)-2-methylidene-4-[(2Z)-penta-2,4-dienylidene]imidazolidine (PubChem CID 143332623) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (4E)-2-methylidene-4-[(2Z)-penta-2,4-dienylidene]imidazolidine.
| Compound Name | (4E)-2-methylidene-4-[(2Z)-penta-2,4-dienylidene]imidazolidine |
|---|---|
| PubChem CID | 143332623 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (4E)-2-methylidene-4-[(2Z)-penta-2,4-dienylidene]imidazolidine |
| SMILES | C=C/C=C\C=C1/CNC(=C)N1 |
| InChI | InChI=1S/C9H12N2/c1-3-4-5-6-9-7-10-8(2)11-9/h3-6,10-11H,1-2,7H2/b5-4-,9-6+ |
| InChIKey | LLVRCMCRHDJKIH-KMOPYBJPSA-N |
| XLogP | 1.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|