C9H12 — CID 143390325
(2E)-1-methyl-2-[(2Z)-penta-2,4-dienylidene]cyclopropane (PubChem CID 143390325) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is (2E)-1-methyl-2-[(2Z)-penta-2,4-dienylidene]cyclopropane.
| Compound Name | (2E)-1-methyl-2-[(2Z)-penta-2,4-dienylidene]cyclopropane |
|---|---|
| PubChem CID | 143390325 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (2E)-1-methyl-2-[(2Z)-penta-2,4-dienylidene]cyclopropane |
| SMILES | C=C/C=C\C=C1/CC1C |
| InChI | InChI=1S/C9H12/c1-3-4-5-6-9-7-8(9)2/h3-6,8H,1,7H2,2H3/b5-4-,9-6+ |
| InChIKey | MECFUTYJKUDPJC-KMOPYBJPSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|